4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid

C10H14N2O2 — CID 81052197

IUPAC4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid
SMILESCCNc1cc(C)nc(C)c1C(=O)O
InChIInChI=1S/C10H14N2O2/c1-4-11-8-5-6(2)12-7(3)9(8)10(13)14/h5H,4H2,1-3H3,(H,11,12)(H,13,14)
InChIKeyGQZXBOCDVIRMQE-UHFFFAOYSA-N
MW194.23 g/mol
LogP1.83
Rot. Bonds3

About 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid

4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid (PubChem CID 81052197) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid
PubChem CID81052197
Molecular FormulaC10H14N2O2
Molecular Weight194.23 g/mol
Exact Mass194.11
IUPAC Name4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid
SMILESCCNc1cc(C)nc(C)c1C(=O)O
InChIInChI=1S/C10H14N2O2/c1-4-11-8-5-6(2)12-7(3)9(8)10(13)14/h5H,4H2,1-3H3,(H,11,12)(H,13,14)
InChIKeyGQZXBOCDVIRMQE-UHFFFAOYSA-N
XLogP1.83
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.23
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid (CID 81052197) is 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid is CCNc1cc(C)nc(C)c1C(=O)O.
What is the InChIKey of 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is GQZXBOCDVIRMQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c1-4-11-8-5-6(2)12-7(3)9(8)10(13)14/h5H,4H2,1-3H3,(H,11,12)(H,13,14).
What are the key properties of 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid?
4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 194.23 g/mol, XLogP of 1.83, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-2,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 81052197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).