About 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide
4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide (PubChem CID 81052434) has the molecular formula C11H13N5
and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide |
| PubChem CID | 81052434 |
| Molecular Formula | C11H13N5 |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(-n2ccnc2)cc(C)nc1C |
| InChI | InChI=1S/C11H13N5/c1-7-5-9(16-4-3-14-6-16)10(11(12)13)8(2)15-7/h3-6H,1-2H3,(H3,12,13) |
| InChIKey | HGCATHIOEXMOGN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide?
The IUPAC name of 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide (CID 81052434) is 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide.
What is the SMILES notation for 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide?
The canonical SMILES for 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide is [H]/N=C(\N)c1c(-n2ccnc2)cc(C)nc1C.
What is the InChIKey of 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide?
The InChIKey is HGCATHIOEXMOGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5/c1-7-5-9(16-4-3-14-6-16)10(11(12)13)8(2)15-7/h3-6H,1-2H3,(H3,12,13).
What are the key properties of 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide?
4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide has a molecular weight of 215.26 g/mol, XLogP of 1.17, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-yl-2,6-dimethylpyridine-3-carboximidamide is sourced from PubChem (CID 81052434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).