C12H15N5S2 — CID 81052540
4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2,6-dimethylpyridine-3-carboximidamide (PubChem CID 81052540) has the molecular formula C12H15N5S2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2,6-dimethylpyridine-3-carboximidamide.
| Compound Name | 4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81052540 |
| Molecular Formula | C12H15N5S2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 4-[(3-ethyl-1,2,4-thiadiazol-5-yl)sulfanyl]-2,6-dimethylpyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(Sc2nc(CC)ns2)cc(C)nc1C |
| InChI | InChI=1S/C12H15N5S2/c1-4-9-16-12(19-17-9)18-8-5-6(2)15-7(3)10(8)11(13)14/h5H,4H2,1-3H3,(H3,13,14) |
| InChIKey | RLBRPZHWQRULCS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|