4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid

C13H17NO3 — CID 81053389

IUPAC4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid
SMILESCc1cc(OC2CCCC2)c(C(=O)O)c(C)n1
InChIInChI=1S/C13H17NO3/c1-8-7-11(17-10-5-3-4-6-10)12(13(15)16)9(2)14-8/h7,10H,3-6H2,1-2H3,(H,15,16)
InChIKeyCMCMVGZYKQVZBX-UHFFFAOYSA-N
MW235.28 g/mol
LogP2.72
Rot. Bonds3

About 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid

4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid (PubChem CID 81053389) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid.

Molecular Properties

Compound Name4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid
PubChem CID81053389
Molecular FormulaC13H17NO3
Molecular Weight235.28 g/mol
Exact Mass235.12
IUPAC Name4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid
SMILESCc1cc(OC2CCCC2)c(C(=O)O)c(C)n1
InChIInChI=1S/C13H17NO3/c1-8-7-11(17-10-5-3-4-6-10)12(13(15)16)9(2)14-8/h7,10H,3-6H2,1-2H3,(H,15,16)
InChIKeyCMCMVGZYKQVZBX-UHFFFAOYSA-N
XLogP2.72
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.28
LogP ≤ 52.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid?
The IUPAC name of 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid (CID 81053389) is 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid.
What is the SMILES notation for 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid?
The canonical SMILES for 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid is Cc1cc(OC2CCCC2)c(C(=O)O)c(C)n1.
What is the InChIKey of 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid?
The InChIKey is CMCMVGZYKQVZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-8-7-11(17-10-5-3-4-6-10)12(13(15)16)9(2)14-8/h7,10H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid?
4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid has a molecular weight of 235.28 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopentyloxy-2,6-dimethylpyridine-3-carboxylic acid is sourced from PubChem (CID 81053389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).