About 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid
3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid (PubChem CID 81053887) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid |
| PubChem CID | 81053887 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid |
| SMILES | Cc1cc(Sc2cccc(C(=O)O)c2)c(C#N)c(C)n1 |
| InChI | InChI=1S/C15H12N2O2S/c1-9-6-14(13(8-16)10(2)17-9)20-12-5-3-4-11(7-12)15(18)19/h3-7H,1-2H3,(H,18,19) |
| InChIKey | ULJSZAJVAGATAO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid?
The IUPAC name of 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid (CID 81053887) is 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid.
What is the SMILES notation for 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid?
The canonical SMILES for 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid is Cc1cc(Sc2cccc(C(=O)O)c2)c(C#N)c(C)n1.
What is the InChIKey of 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid?
The InChIKey is ULJSZAJVAGATAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c1-9-6-14(13(8-16)10(2)17-9)20-12-5-3-4-11(7-12)15(18)19/h3-7H,1-2H3,(H,18,19).
What are the key properties of 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid?
3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid has a molecular weight of 284.34 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-cyano-2,6-dimethyl-4-pyridinyl)sulfanyl]benzoic acid is sourced from PubChem (CID 81053887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).