About 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide
4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide (PubChem CID 81053967) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide |
| PubChem CID | 81053967 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide |
| SMILES | Cc1cc(-n2nc(C)cc2C)c(/C(N)=N/O)c(C)n1 |
| InChI | InChI=1S/C13H17N5O/c1-7-6-11(18-9(3)5-8(2)16-18)12(10(4)15-7)13(14)17-19/h5-6,19H,1-4H3,(H2,14,17) |
| InChIKey | XUTXDMPPLYPIQG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide?
The IUPAC name of 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide (CID 81053967) is 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide.
What is the SMILES notation for 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide?
The canonical SMILES for 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide is Cc1cc(-n2nc(C)cc2C)c(/C(N)=N/O)c(C)n1.
What is the InChIKey of 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide?
The InChIKey is XUTXDMPPLYPIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-7-6-11(18-9(3)5-8(2)16-18)12(10(4)15-7)13(14)17-19/h5-6,19H,1-4H3,(H2,14,17).
What are the key properties of 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide?
4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide has a molecular weight of 259.31 g/mol, XLogP of 1.60, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylpyrazol-1-yl)-N'-hydroxy-2,6-dimethylpyridine-3-carboximidamide is sourced from PubChem (CID 81053967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).