About 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide
2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide (PubChem CID 81054283) has the molecular formula C13H19N3OS
and a molecular weight of 265.38 g/mol. Its IUPAC name is 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide |
| PubChem CID | 81054283 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide |
| SMILES | Cc1cc(N2CCCOCC2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C13H19N3OS/c1-9-8-11(12(13(14)18)10(2)15-9)16-4-3-6-17-7-5-16/h8H,3-7H2,1-2H3,(H2,14,18) |
| InChIKey | YVOVRCOYQLSQBL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide?
The IUPAC name of 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide (CID 81054283) is 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide.
What is the SMILES notation for 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide?
The canonical SMILES for 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide is Cc1cc(N2CCCOCC2)c(C(N)=S)c(C)n1.
What is the InChIKey of 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide?
The InChIKey is YVOVRCOYQLSQBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3OS/c1-9-8-11(12(13(14)18)10(2)15-9)16-4-3-6-17-7-5-16/h8H,3-7H2,1-2H3,(H2,14,18).
What are the key properties of 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide?
2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide has a molecular weight of 265.38 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-(1,4-oxazepan-4-yl)pyridine-3-carbothioamide is sourced from PubChem (CID 81054283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).