C12H16F3N3OS — CID 81054493
2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbothioamide (PubChem CID 81054493) has the molecular formula C12H16F3N3OS and a molecular weight of 307.34 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbothioamide.
| Compound Name | 2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81054493 |
| Molecular Formula | C12H16F3N3OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbothioamide |
| SMILES | Cc1cc(NCCOCC(F)(F)F)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C12H16F3N3OS/c1-7-5-9(10(11(16)20)8(2)18-7)17-3-4-19-6-12(13,14)15/h5H,3-4,6H2,1-2H3,(H2,16,20)(H,17,18) |
| InChIKey | OYJBMFVUAQCURY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|