C12H19N3O3 — CID 81054528
N'-hydroxy-4-(1-methoxypropan-2-yloxy)-2,6-dimethylpyridine-3-carboximidamide (PubChem CID 81054528) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N'-hydroxy-4-(1-methoxypropan-2-yloxy)-2,6-dimethylpyridine-3-carboximidamide.
| Compound Name | N'-hydroxy-4-(1-methoxypropan-2-yloxy)-2,6-dimethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 81054528 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N'-hydroxy-4-(1-methoxypropan-2-yloxy)-2,6-dimethylpyridine-3-carboximidamide |
| SMILES | COCC(C)Oc1cc(C)nc(C)c1/C(N)=N/O |
| InChI | InChI=1S/C12H19N3O3/c1-7-5-10(18-8(2)6-17-4)11(9(3)14-7)12(13)15-16/h5,8,16H,6H2,1-4H3,(H2,13,15) |
| InChIKey | SWSBUFUDXMERCC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|