C11H19N3O3 — CID 81056227
5-[2-ethoxyethyl(methyl)amino]-1,3-dimethylpyrazole-4-carboxylic acid (PubChem CID 81056227) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 5-[2-ethoxyethyl(methyl)amino]-1,3-dimethylpyrazole-4-carboxylic acid.
| Compound Name | 5-[2-ethoxyethyl(methyl)amino]-1,3-dimethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 81056227 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 5-[2-ethoxyethyl(methyl)amino]-1,3-dimethylpyrazole-4-carboxylic acid |
| SMILES | CCOCCN(C)c1c(C(=O)O)c(C)nn1C |
| InChI | InChI=1S/C11H19N3O3/c1-5-17-7-6-13(3)10-9(11(15)16)8(2)12-14(10)4/h5-7H2,1-4H3,(H,15,16) |
| InChIKey | QXOPLAKXWQYUSA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|