About 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide
1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide (PubChem CID 81056700) has the molecular formula C13H24N2O2S
and a molecular weight of 272.41 g/mol. Its IUPAC name is 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide |
| PubChem CID | 81056700 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide |
| SMILES | CC1CC(C(=O)N(C)CCOC(C)C)(C(N)=S)C1 |
| InChI | InChI=1S/C13H24N2O2S/c1-9(2)17-6-5-15(4)12(16)13(11(14)18)7-10(3)8-13/h9-10H,5-8H2,1-4H3,(H2,14,18) |
| InChIKey | KLQIQCWTDQVHAU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide?
The IUPAC name of 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide (CID 81056700) is 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide is CC1CC(C(=O)N(C)CCOC(C)C)(C(N)=S)C1.
What is the InChIKey of 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide?
The InChIKey is KLQIQCWTDQVHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2S/c1-9(2)17-6-5-15(4)12(16)13(11(14)18)7-10(3)8-13/h9-10H,5-8H2,1-4H3,(H2,14,18).
What are the key properties of 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide?
1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide has a molecular weight of 272.41 g/mol, XLogP of 1.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-carbamothioyl-N,3-dimethyl-N-(2-propan-2-yloxyethyl)cyclobutane-1-carboxamide is sourced from PubChem (CID 81056700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).