C12H20N4 — CID 81057520
[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopentyl]methanamine (PubChem CID 81057520) has the molecular formula C12H20N4 and a molecular weight of 220.32 g/mol. Its IUPAC name is [2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopentyl]methanamine.
| Compound Name | [2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopentyl]methanamine |
|---|---|
| PubChem CID | 81057520 |
| Molecular Formula | C12H20N4 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopentyl]methanamine |
| SMILES | NCC1CCCC1c1nnc2n1CCCC2 |
| InChI | InChI=1S/C12H20N4/c13-8-9-4-3-5-10(9)12-15-14-11-6-1-2-7-16(11)12/h9-10H,1-8,13H2 |
| InChIKey | IVZUOJKCRMLGBH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |