C11H16N4 — CID 81057521
4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopent-2-en-1-amine (PubChem CID 81057521) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopent-2-en-1-amine.
| Compound Name | 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopent-2-en-1-amine |
|---|---|
| PubChem CID | 81057521 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)cyclopent-2-en-1-amine |
| SMILES | NC1C=CC(c2nnc3n2CCCC3)C1 |
| InChI | InChI=1S/C11H16N4/c12-9-5-4-8(7-9)11-14-13-10-3-1-2-6-15(10)11/h4-5,8-9H,1-3,6-7,12H2 |
| InChIKey | TXPDFMNSWKQYEB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|