C13H21NO2 — CID 81058166
[4-[2-ethoxyethyl(methyl)amino]-3-methylphenyl]methanol (PubChem CID 81058166) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is [4-[2-ethoxyethyl(methyl)amino]-3-methylphenyl]methanol.
| Compound Name | [4-[2-ethoxyethyl(methyl)amino]-3-methylphenyl]methanol |
|---|---|
| PubChem CID | 81058166 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | [4-[2-ethoxyethyl(methyl)amino]-3-methylphenyl]methanol |
| SMILES | CCOCCN(C)c1ccc(CO)cc1C |
| InChI | InChI=1S/C13H21NO2/c1-4-16-8-7-14(3)13-6-5-12(10-15)9-11(13)2/h5-6,9,15H,4,7-8,10H2,1-3H3 |
| InChIKey | XPEPIJRGTSHURY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|