C14H21BrN2O3 — CID 81058893
1-(7-bromo-1,3-benzodioxol-5-yl)-N-(2-ethoxyethyl)-N-methylethane-1,2-diamine (PubChem CID 81058893) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 1-(7-bromo-1,3-benzodioxol-5-yl)-N-(2-ethoxyethyl)-N-methylethane-1,2-diamine.
| Compound Name | 1-(7-bromo-1,3-benzodioxol-5-yl)-N-(2-ethoxyethyl)-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 81058893 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(7-bromo-1,3-benzodioxol-5-yl)-N-(2-ethoxyethyl)-N-methylethane-1,2-diamine |
| SMILES | CCOCCN(C)C(CN)c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H21BrN2O3/c1-3-18-5-4-17(2)12(8-16)10-6-11(15)14-13(7-10)19-9-20-14/h6-7,12H,3-5,8-9,16H2,1-2H3 |
| InChIKey | BLNZAKGPODZFJK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|