C11H25N3O — CID 81059404
3-(aminomethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrolidin-3-amine (PubChem CID 81059404) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrolidin-3-amine.
| Compound Name | 3-(aminomethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 81059404 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 3-(aminomethyl)-N-(2-ethoxyethyl)-N,1-dimethylpyrrolidin-3-amine |
| SMILES | CCOCCN(C)C1(CN)CCN(C)C1 |
| InChI | InChI=1S/C11H25N3O/c1-4-15-8-7-14(3)11(9-12)5-6-13(2)10-11/h4-10,12H2,1-3H3 |
| InChIKey | LHRRYMXNLNZVOT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|