C12H14F3N3O — CID 81059816
2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbonitrile (PubChem CID 81059816) has the molecular formula C12H14F3N3O and a molecular weight of 273.26 g/mol. Its IUPAC name is 2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbonitrile.
| Compound Name | 2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 81059816 |
| Molecular Formula | C12H14F3N3O |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2,6-dimethyl-4-[2-(2,2,2-trifluoroethoxy)ethylamino]pyridine-3-carbonitrile |
| SMILES | Cc1cc(NCCOCC(F)(F)F)c(C#N)c(C)n1 |
| InChI | InChI=1S/C12H14F3N3O/c1-8-5-11(10(6-16)9(2)18-8)17-3-4-19-7-12(13,14)15/h5H,3-4,7H2,1-2H3,(H,17,18) |
| InChIKey | IXYVYVRVKFTYMI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|