C16H34N2O3 — CID 81062894
methyl 2-methyl-5-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)pentanoate (PubChem CID 81062894) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is methyl 2-methyl-5-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)pentanoate.
| Compound Name | methyl 2-methyl-5-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)pentanoate |
|---|---|
| PubChem CID | 81062894 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | methyl 2-methyl-5-[methyl(2-propan-2-yloxyethyl)amino]-2-(propan-2-ylamino)pentanoate |
| SMILES | COC(=O)C(C)(CCCN(C)CCOC(C)C)NC(C)C |
| InChI | InChI=1S/C16H34N2O3/c1-13(2)17-16(5,15(19)20-7)9-8-10-18(6)11-12-21-14(3)4/h13-14,17H,8-12H2,1-7H3 |
| InChIKey | QNLPYJFNRCIUQA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |