About 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine
1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine (PubChem CID 81063269) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine.
Molecular Properties
| Compound Name | 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine |
| PubChem CID | 81063269 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine |
| SMILES | CC(C)OCCN(C)C1CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H24N2O/c1-11(2)18-9-8-17(3)15-7-4-12-10-13(16)5-6-14(12)15/h5-6,10-11,15H,4,7-9,16H2,1-3H3 |
| InChIKey | QHLJIXDSZYIWQH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine?
The IUPAC name of 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine (CID 81063269) is 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine.
What is the SMILES notation for 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine?
The canonical SMILES for 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine is CC(C)OCCN(C)C1CCc2cc(N)ccc21.
What is the InChIKey of 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine?
The InChIKey is QHLJIXDSZYIWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-11(2)18-9-8-17(3)15-7-4-12-10-13(16)5-6-14(12)15/h5-6,10-11,15H,4,7-9,16H2,1-3H3.
What are the key properties of 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine?
1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine has a molecular weight of 248.37 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-1-N-(2-propan-2-yloxyethyl)-2,3-dihydro-1H-indene-1,5-diamine is sourced from PubChem (CID 81063269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).