C15H24N2O4 — CID 81063469
3-[[[1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]methyl]pentanoic acid (PubChem CID 81063469) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-[[[1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]methyl]pentanoic acid.
| Compound Name | 3-[[[1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 81063469 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-[[[1-(cyclopropylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)C1CC(=O)N(CC2CC2)C1)CC(=O)O |
| InChI | InChI=1S/C15H24N2O4/c1-2-10(5-14(19)20)7-16-15(21)12-6-13(18)17(9-12)8-11-3-4-11/h10-12H,2-9H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | ZIRKNARKLLVBMT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |