C13H26N4O3S — CID 81064184
N-(2-ethoxyethyl)-N,5-dimethyl-4-(propylaminomethyl)-1H-pyrazole-3-sulfonamide (PubChem CID 81064184) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N,5-dimethyl-4-(propylaminomethyl)-1H-pyrazole-3-sulfonamide.
| Compound Name | N-(2-ethoxyethyl)-N,5-dimethyl-4-(propylaminomethyl)-1H-pyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 81064184 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | N-(2-ethoxyethyl)-N,5-dimethyl-4-(propylaminomethyl)-1H-pyrazole-3-sulfonamide |
| SMILES | CCCNCc1c(S(=O)(=O)N(C)CCOCC)n[nH]c1C |
| InChI | InChI=1S/C13H26N4O3S/c1-5-7-14-10-12-11(3)15-16-13(12)21(18,19)17(4)8-9-20-6-2/h14H,5-10H2,1-4H3,(H,15,16) |
| InChIKey | MUNHGSYITOSFNW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|