About 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid
3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid (PubChem CID 81065330) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid.
Molecular Properties
| Compound Name | 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid |
| PubChem CID | 81065330 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid |
| SMILES | CCc1nnc(NCC(CC)CC(=O)O)c(C#N)c1CC |
| InChI | InChI=1S/C15H22N4O2/c1-4-10(7-14(20)21)9-17-15-12(8-16)11(5-2)13(6-3)18-19-15/h10H,4-7,9H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | NGQCQKCPPIEYFK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid?
The IUPAC name of 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid (CID 81065330) is 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid.
What is the SMILES notation for 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid?
The canonical SMILES for 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid is CCc1nnc(NCC(CC)CC(=O)O)c(C#N)c1CC.
What is the InChIKey of 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid?
The InChIKey is NGQCQKCPPIEYFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-4-10(7-14(20)21)9-17-15-12(8-16)11(5-2)13(6-3)18-19-15/h10H,4-7,9H2,1-3H3,(H,17,19)(H,20,21).
What are the key properties of 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid?
3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid has a molecular weight of 290.37 g/mol, XLogP of 2.39, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(4-cyano-5,6-diethylpyridazin-3-yl)amino]methyl]pentanoic acid is sourced from PubChem (CID 81065330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).