About 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid
4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid (PubChem CID 81067960) has the molecular formula C13H14F2N4O2
and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid |
| PubChem CID | 81067960 |
| Molecular Formula | C13H14F2N4O2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid |
| SMILES | CC(CC(=O)O)Cn1nnnc1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H14F2N4O2/c1-8(4-13(20)21)7-19-12(16-17-18-19)6-9-2-3-10(14)11(15)5-9/h2-3,5,8H,4,6-7H2,1H3,(H,20,21) |
| InChIKey | MEDZWZFJJSNTLG-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid?
The IUPAC name of 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid (CID 81067960) is 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid.
What is the SMILES notation for 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid?
The canonical SMILES for 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid is CC(CC(=O)O)Cn1nnnc1Cc1ccc(F)c(F)c1.
What is the InChIKey of 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid?
The InChIKey is MEDZWZFJJSNTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N4O2/c1-8(4-13(20)21)7-19-12(16-17-18-19)6-9-2-3-10(14)11(15)5-9/h2-3,5,8H,4,6-7H2,1H3,(H,20,21).
What are the key properties of 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid?
4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid has a molecular weight of 296.28 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(3,4-difluorophenyl)methyl]tetrazol-1-yl]-3-methylbutanoic acid is sourced from PubChem (CID 81067960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).