C12H21BrN4O — CID 81068013
5-bromo-4-N-(2-ethoxyethyl)-4-N-methyl-2-N-propylpyrimidine-2,4-diamine (PubChem CID 81068013) has the molecular formula C12H21BrN4O and a molecular weight of 317.23 g/mol. Its IUPAC name is 5-bromo-4-N-(2-ethoxyethyl)-4-N-methyl-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 5-bromo-4-N-(2-ethoxyethyl)-4-N-methyl-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 81068013 |
| Molecular Formula | C12H21BrN4O |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-bromo-4-N-(2-ethoxyethyl)-4-N-methyl-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ncc(Br)c(N(C)CCOCC)n1 |
| InChI | InChI=1S/C12H21BrN4O/c1-4-6-14-12-15-9-10(13)11(16-12)17(3)7-8-18-5-2/h9H,4-8H2,1-3H3,(H,14,15,16) |
| InChIKey | DQBAMEOZIZOIRT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|