About 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine
4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine (PubChem CID 81068833) has the molecular formula C14H26N4O
and a molecular weight of 266.39 g/mol. Its IUPAC name is 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine |
| PubChem CID | 81068833 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine |
| SMILES | Cc1c(N)nc(C(C)C)nc1N(C)CCOC(C)C |
| InChI | InChI=1S/C14H26N4O/c1-9(2)13-16-12(15)11(5)14(17-13)18(6)7-8-19-10(3)4/h9-10H,7-8H2,1-6H3,(H2,15,16,17) |
| InChIKey | CSBCOOMUZUVBES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine?
The IUPAC name of 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine (CID 81068833) is 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine.
What is the SMILES notation for 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine?
The canonical SMILES for 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine is Cc1c(N)nc(C(C)C)nc1N(C)CCOC(C)C.
What is the InChIKey of 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine?
The InChIKey is CSBCOOMUZUVBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N4O/c1-9(2)13-16-12(15)11(5)14(17-13)18(6)7-8-19-10(3)4/h9-10H,7-8H2,1-6H3,(H2,15,16,17).
What are the key properties of 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine?
4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine has a molecular weight of 266.39 g/mol, XLogP of 2.35, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,5-dimethyl-2-propan-2-yl-4-N-(2-propan-2-yloxyethyl)pyrimidine-4,6-diamine is sourced from PubChem (CID 81068833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).