About 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid
3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid (PubChem CID 81069320) has the molecular formula C12H19N3O5
and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid.
Molecular Properties
| Compound Name | 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid |
| PubChem CID | 81069320 |
| Molecular Formula | C12H19N3O5 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid |
| SMILES | CCC(CNC(=O)N1CC(=O)NC(=O)C1C)CC(=O)O |
| InChI | InChI=1S/C12H19N3O5/c1-3-8(4-10(17)18)5-13-12(20)15-6-9(16)14-11(19)7(15)2/h7-8H,3-6H2,1-2H3,(H,13,20)(H,17,18)(H,14,16,19) |
| InChIKey | OHKLUKZMXNIKGL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid?
The IUPAC name of 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid (CID 81069320) is 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid.
What is the SMILES notation for 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid?
The canonical SMILES for 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid is CCC(CNC(=O)N1CC(=O)NC(=O)C1C)CC(=O)O.
What is the InChIKey of 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid?
The InChIKey is OHKLUKZMXNIKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O5/c1-3-8(4-10(17)18)5-13-12(20)15-6-9(16)14-11(19)7(15)2/h7-8H,3-6H2,1-2H3,(H,13,20)(H,17,18)(H,14,16,19).
What are the key properties of 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid?
3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid has a molecular weight of 285.30 g/mol, XLogP of -0.46, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2-methyl-3,5-dioxopiperazine-1-carbonyl)amino]methyl]pentanoic acid is sourced from PubChem (CID 81069320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).