About 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid
4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid (PubChem CID 81069680) has the molecular formula C11H17N3O5
and a molecular weight of 271.27 g/mol. Its IUPAC name is 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid.
Molecular Properties
| Compound Name | 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid |
| PubChem CID | 81069680 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(CNC(=O)NC1CCC(=O)NC1=O)CC(=O)O |
| InChI | InChI=1S/C11H17N3O5/c1-6(4-9(16)17)5-12-11(19)13-7-2-3-8(15)14-10(7)18/h6-7H,2-5H2,1H3,(H,16,17)(H2,12,13,19)(H,14,15,18) |
| InChIKey | ZEFJXESATDPENU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid?
The IUPAC name of 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid (CID 81069680) is 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid.
What is the SMILES notation for 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid?
The canonical SMILES for 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid is CC(CNC(=O)NC1CCC(=O)NC1=O)CC(=O)O.
What is the InChIKey of 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid?
The InChIKey is ZEFJXESATDPENU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O5/c1-6(4-9(16)17)5-12-11(19)13-7-2-3-8(15)14-10(7)18/h6-7H,2-5H2,1H3,(H,16,17)(H2,12,13,19)(H,14,15,18).
What are the key properties of 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid?
4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid has a molecular weight of 271.27 g/mol, XLogP of -0.80, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,6-dioxopiperidin-3-yl)carbamoylamino]-3-methylbutanoic acid is sourced from PubChem (CID 81069680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).