C10H20N2OS — CID 81070662
4-amino-N,3-dimethyl-N-(thiolan-3-yl)butanamide (PubChem CID 81070662) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 4-amino-N,3-dimethyl-N-(thiolan-3-yl)butanamide.
| Compound Name | 4-amino-N,3-dimethyl-N-(thiolan-3-yl)butanamide |
|---|---|
| PubChem CID | 81070662 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 4-amino-N,3-dimethyl-N-(thiolan-3-yl)butanamide |
| SMILES | CC(CN)CC(=O)N(C)C1CCSC1 |
| InChI | InChI=1S/C10H20N2OS/c1-8(6-11)5-10(13)12(2)9-3-4-14-7-9/h8-9H,3-7,11H2,1-2H3 |
| InChIKey | RYUZFPJLWGEUIN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |