C15H22F2N2O2 — CID 81071463
2-amino-N-[(3,4-difluorophenyl)methyl]-N-ethyl-5-methoxypentanamide (PubChem CID 81071463) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-amino-N-[(3,4-difluorophenyl)methyl]-N-ethyl-5-methoxypentanamide.
| Compound Name | 2-amino-N-[(3,4-difluorophenyl)methyl]-N-ethyl-5-methoxypentanamide |
|---|---|
| PubChem CID | 81071463 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-amino-N-[(3,4-difluorophenyl)methyl]-N-ethyl-5-methoxypentanamide |
| SMILES | CCN(Cc1ccc(F)c(F)c1)C(=O)C(N)CCCOC |
| InChI | InChI=1S/C15H22F2N2O2/c1-3-19(15(20)14(18)5-4-8-21-2)10-11-6-7-12(16)13(17)9-11/h6-7,9,14H,3-5,8,10,18H2,1-2H3 |
| InChIKey | ZGPKCXIQAYYPDW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|