C12H16FN3 — CID 81072710
2-[(4-fluoro-1H-benzimidazol-2-yl)methyl]butan-1-amine (PubChem CID 81072710) has the molecular formula C12H16FN3 and a molecular weight of 221.28 g/mol. Its IUPAC name is 2-[(4-fluoro-1H-benzimidazol-2-yl)methyl]butan-1-amine.
| Compound Name | 2-[(4-fluoro-1H-benzimidazol-2-yl)methyl]butan-1-amine |
|---|---|
| PubChem CID | 81072710 |
| Molecular Formula | C12H16FN3 |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 2-[(4-fluoro-1H-benzimidazol-2-yl)methyl]butan-1-amine |
| SMILES | CCC(CN)Cc1nc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C12H16FN3/c1-2-8(7-14)6-11-15-10-5-3-4-9(13)12(10)16-11/h3-5,8H,2,6-7,14H2,1H3,(H,15,16) |
| InChIKey | PGESAGOCDPFYFF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |