About 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid
3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid (PubChem CID 81073507) has the molecular formula C10H17NO4
and a molecular weight of 215.25 g/mol. Its IUPAC name is 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid.
Molecular Properties
| Compound Name | 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid |
| PubChem CID | 81073507 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid |
| SMILES | CCC(CC(=O)O)CN1CCCOC1=O |
| InChI | InChI=1S/C10H17NO4/c1-2-8(6-9(12)13)7-11-4-3-5-15-10(11)14/h8H,2-7H2,1H3,(H,12,13) |
| InChIKey | LFEHILMMMDMBGF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid?
The IUPAC name of 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid (CID 81073507) is 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid.
What is the SMILES notation for 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid?
The canonical SMILES for 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid is CCC(CC(=O)O)CN1CCCOC1=O.
What is the InChIKey of 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid?
The InChIKey is LFEHILMMMDMBGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO4/c1-2-8(6-9(12)13)7-11-4-3-5-15-10(11)14/h8H,2-7H2,1H3,(H,12,13).
What are the key properties of 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid?
3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid has a molecular weight of 215.25 g/mol, XLogP of 1.33, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-oxo-1,3-oxazinan-3-yl)methyl]pentanoic acid is sourced from PubChem (CID 81073507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).