C11H12Cl2N2O4 — CID 81076508
2-[(3,4-dichlorophenyl)carbamoylamino]-3-methoxypropanoic acid (PubChem CID 81076508) has the molecular formula C11H12Cl2N2O4 and a molecular weight of 307.13 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoylamino]-3-methoxypropanoic acid.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoylamino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81076508 |
| Molecular Formula | C11H12Cl2N2O4 |
| Molecular Weight | 307.13 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoylamino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C11H12Cl2N2O4/c1-19-5-9(10(16)17)15-11(18)14-6-2-3-7(12)8(13)4-6/h2-4,9H,5H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | QDAUUHSMAVWCRN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |