2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid

C15H21NO4 — CID 81077142

IUPAC2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid
SMILESCOCCCC(NC(=O)c1ccc(C)c(C)c1)C(=O)O
InChIInChI=1S/C15H21NO4/c1-10-6-7-12(9-11(10)2)14(17)16-13(15(18)19)5-4-8-20-3/h6-7,9,13H,4-5,8H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyDKTPQXYFPUBKOF-UHFFFAOYSA-N
MW279.34 g/mol
LogP1.91
Rot. Bonds7

About 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid

2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid (PubChem CID 81077142) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid.

Molecular Properties

Compound Name2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid
PubChem CID81077142
Molecular FormulaC15H21NO4
Molecular Weight279.34 g/mol
Exact Mass279.15
IUPAC Name2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid
SMILESCOCCCC(NC(=O)c1ccc(C)c(C)c1)C(=O)O
InChIInChI=1S/C15H21NO4/c1-10-6-7-12(9-11(10)2)14(17)16-13(15(18)19)5-4-8-20-3/h6-7,9,13H,4-5,8H2,1-3H3,(H,16,17)(H,18,19)
InChIKeyDKTPQXYFPUBKOF-UHFFFAOYSA-N
XLogP1.91
TPSA75.63 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.34
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid?
The IUPAC name of 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid (CID 81077142) is 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid.
What is the SMILES notation for 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid?
The canonical SMILES for 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid is COCCCC(NC(=O)c1ccc(C)c(C)c1)C(=O)O.
What is the InChIKey of 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid?
The InChIKey is DKTPQXYFPUBKOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO4/c1-10-6-7-12(9-11(10)2)14(17)16-13(15(18)19)5-4-8-20-3/h6-7,9,13H,4-5,8H2,1-3H3,(H,16,17)(H,18,19).
What are the key properties of 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid?
2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid has a molecular weight of 279.34 g/mol, XLogP of 1.91, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethylbenzoyl)amino]-5-methoxypentanoic acid is sourced from PubChem (CID 81077142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).