C13H18N4O3 — CID 81078165
5-methoxy-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]pentanoic acid (PubChem CID 81078165) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-methoxy-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]pentanoic acid.
| Compound Name | 5-methoxy-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 81078165 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-methoxy-2-[(7-methyl-[1,2,4]triazolo[1,5-a]pyridin-5-yl)amino]pentanoic acid |
| SMILES | COCCCC(Nc1cc(C)cc2ncnn12)C(=O)O |
| InChI | InChI=1S/C13H18N4O3/c1-9-6-11-14-8-15-17(11)12(7-9)16-10(13(18)19)4-3-5-20-2/h6-8,10,16H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | JCDMIYIFSWOQBH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|