About 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid
2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid (PubChem CID 81078416) has the molecular formula C12H17N3O4
and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid.
Molecular Properties
| Compound Name | 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid |
| PubChem CID | 81078416 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid |
| SMILES | COCC(Nc1nc(C)cc(C)c1C(N)=O)C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-6-4-7(2)14-11(9(6)10(13)16)15-8(5-19-3)12(17)18/h4,8H,5H2,1-3H3,(H2,13,16)(H,14,15)(H,17,18) |
| InChIKey | HZEMOGRZXOYZLP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid?
The IUPAC name of 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid (CID 81078416) is 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid.
What is the SMILES notation for 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid?
The canonical SMILES for 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid is COCC(Nc1nc(C)cc(C)c1C(N)=O)C(=O)O.
What is the InChIKey of 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid?
The InChIKey is HZEMOGRZXOYZLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-6-4-7(2)14-11(9(6)10(13)16)15-8(5-19-3)12(17)18/h4,8H,5H2,1-3H3,(H2,13,16)(H,14,15)(H,17,18).
What are the key properties of 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid?
2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid has a molecular weight of 267.28 g/mol, XLogP of 0.31, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-carbamoyl-4,6-dimethyl-2-pyridinyl)amino]-3-methoxypropanoic acid is sourced from PubChem (CID 81078416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).