C11H14N2OS — CID 81079007
2-methoxy-1-(5-methyl-1,3-benzothiazol-2-yl)ethanamine (PubChem CID 81079007) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-methoxy-1-(5-methyl-1,3-benzothiazol-2-yl)ethanamine.
| Compound Name | 2-methoxy-1-(5-methyl-1,3-benzothiazol-2-yl)ethanamine |
|---|---|
| PubChem CID | 81079007 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-methoxy-1-(5-methyl-1,3-benzothiazol-2-yl)ethanamine |
| SMILES | COCC(N)c1nc2cc(C)ccc2s1 |
| InChI | InChI=1S/C11H14N2OS/c1-7-3-4-10-9(5-7)13-11(15-10)8(12)6-14-2/h3-5,8H,6,12H2,1-2H3 |
| InChIKey | XZUKQIQUNIBTTO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |