C11H20N2O — CID 81079891
N'-(furan-2-ylmethyl)-N',2-dimethylbutane-1,4-diamine (PubChem CID 81079891) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N',2-dimethylbutane-1,4-diamine.
| Compound Name | N'-(furan-2-ylmethyl)-N',2-dimethylbutane-1,4-diamine |
|---|---|
| PubChem CID | 81079891 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N',2-dimethylbutane-1,4-diamine |
| SMILES | CC(CN)CCN(C)Cc1ccco1 |
| InChI | InChI=1S/C11H20N2O/c1-10(8-12)5-6-13(2)9-11-4-3-7-14-11/h3-4,7,10H,5-6,8-9,12H2,1-2H3 |
| InChIKey | CNGWSMZJVGSAPT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |