About 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine
2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine (PubChem CID 81080353) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine |
| PubChem CID | 81080353 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine |
| SMILES | CCC(CN)CCNCC(C)C |
| InChI | InChI=1S/C10H24N2/c1-4-10(7-11)5-6-12-8-9(2)3/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | DOBHDQTUQNVRKC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine?
The IUPAC name of 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine (CID 81080353) is 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine.
What is the SMILES notation for 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine?
The canonical SMILES for 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine is CCC(CN)CCNCC(C)C.
What is the InChIKey of 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine?
The InChIKey is DOBHDQTUQNVRKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-4-10(7-11)5-6-12-8-9(2)3/h9-10,12H,4-8,11H2,1-3H3.
What are the key properties of 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine?
2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine has a molecular weight of 172.32 g/mol, XLogP of 1.61, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N'-(2-methylpropyl)butane-1,4-diamine is sourced from PubChem (CID 81080353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).