C12H19N3O — CID 81081120
3-(3-methoxypropyl)-8-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine (PubChem CID 81081120) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-8-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine.
| Compound Name | 3-(3-methoxypropyl)-8-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine |
|---|---|
| PubChem CID | 81081120 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-(3-methoxypropyl)-8-methyl-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine |
| SMILES | COCCCC1CNc2c(C)ccnc2N1 |
| InChI | InChI=1S/C12H19N3O/c1-9-5-6-13-12-11(9)14-8-10(15-12)4-3-7-16-2/h5-6,10,14H,3-4,7-8H2,1-2H3,(H,13,15) |
| InChIKey | LYIQUHLGABYWEA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|