C11H18N4O4 — CID 81081195
2-(1H-imidazol-5-ylmethylcarbamoylamino)-5-methoxypentanoic acid (PubChem CID 81081195) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(1H-imidazol-5-ylmethylcarbamoylamino)-5-methoxypentanoic acid.
| Compound Name | 2-(1H-imidazol-5-ylmethylcarbamoylamino)-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81081195 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-(1H-imidazol-5-ylmethylcarbamoylamino)-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)NCc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C11H18N4O4/c1-19-4-2-3-9(10(16)17)15-11(18)13-6-8-5-12-7-14-8/h5,7,9H,2-4,6H2,1H3,(H,12,14)(H,16,17)(H2,13,15,18) |
| InChIKey | ZQVBIQBHUSOACR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|