About 5-(3-methoxypropyl)imidazolidine-2,4-dione
5-(3-methoxypropyl)imidazolidine-2,4-dione (PubChem CID 81081595) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is 5-(3-methoxypropyl)imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(3-methoxypropyl)imidazolidine-2,4-dione |
| PubChem CID | 81081595 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 5-(3-methoxypropyl)imidazolidine-2,4-dione |
| SMILES | COCCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C7H12N2O3/c1-12-4-2-3-5-6(10)9-7(11)8-5/h5H,2-4H2,1H3,(H2,8,9,10,11) |
| InChIKey | ISXJPBSBEBVHPJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-methoxypropyl)imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methoxypropyl)imidazolidine-2,4-dione?
The IUPAC name of 5-(3-methoxypropyl)imidazolidine-2,4-dione (CID 81081595) is 5-(3-methoxypropyl)imidazolidine-2,4-dione.
What is the SMILES notation for 5-(3-methoxypropyl)imidazolidine-2,4-dione?
The canonical SMILES for 5-(3-methoxypropyl)imidazolidine-2,4-dione is COCCCC1NC(=O)NC1=O.
What is the InChIKey of 5-(3-methoxypropyl)imidazolidine-2,4-dione?
The InChIKey is ISXJPBSBEBVHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-12-4-2-3-5-6(10)9-7(11)8-5/h5H,2-4H2,1H3,(H2,8,9,10,11).
What are the key properties of 5-(3-methoxypropyl)imidazolidine-2,4-dione?
5-(3-methoxypropyl)imidazolidine-2,4-dione has a molecular weight of 172.18 g/mol, XLogP of -0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methoxypropyl)imidazolidine-2,4-dione is sourced from PubChem (CID 81081595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).