About 2-amino-5-methoxy-N-methyl-N-pentylpentanamide
2-amino-5-methoxy-N-methyl-N-pentylpentanamide (PubChem CID 81082325) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-amino-5-methoxy-N-methyl-N-pentylpentanamide.
Molecular Properties
| Compound Name | 2-amino-5-methoxy-N-methyl-N-pentylpentanamide |
| PubChem CID | 81082325 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-amino-5-methoxy-N-methyl-N-pentylpentanamide |
| SMILES | CCCCCN(C)C(=O)C(N)CCCOC |
| InChI | InChI=1S/C12H26N2O2/c1-4-5-6-9-14(2)12(15)11(13)8-7-10-16-3/h11H,4-10,13H2,1-3H3 |
| InChIKey | BJVHHGSCFOKIHP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5-methoxy-N-methyl-N-pentylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5-methoxy-N-methyl-N-pentylpentanamide?
The IUPAC name of 2-amino-5-methoxy-N-methyl-N-pentylpentanamide (CID 81082325) is 2-amino-5-methoxy-N-methyl-N-pentylpentanamide.
What is the SMILES notation for 2-amino-5-methoxy-N-methyl-N-pentylpentanamide?
The canonical SMILES for 2-amino-5-methoxy-N-methyl-N-pentylpentanamide is CCCCCN(C)C(=O)C(N)CCCOC.
What is the InChIKey of 2-amino-5-methoxy-N-methyl-N-pentylpentanamide?
The InChIKey is BJVHHGSCFOKIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2/c1-4-5-6-9-14(2)12(15)11(13)8-7-10-16-3/h11H,4-10,13H2,1-3H3.
What are the key properties of 2-amino-5-methoxy-N-methyl-N-pentylpentanamide?
2-amino-5-methoxy-N-methyl-N-pentylpentanamide has a molecular weight of 230.35 g/mol, XLogP of 1.39, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5-methoxy-N-methyl-N-pentylpentanamide is sourced from PubChem (CID 81082325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).