C11H21N3O3 — CID 81083280
N-[1-(2-amino-3-methoxypropanoyl)piperidin-3-yl]acetamide (PubChem CID 81083280) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[1-(2-amino-3-methoxypropanoyl)piperidin-3-yl]acetamide.
| Compound Name | N-[1-(2-amino-3-methoxypropanoyl)piperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 81083280 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-[1-(2-amino-3-methoxypropanoyl)piperidin-3-yl]acetamide |
| SMILES | COCC(N)C(=O)N1CCCC(NC(C)=O)C1 |
| InChI | InChI=1S/C11H21N3O3/c1-8(15)13-9-4-3-5-14(6-9)11(16)10(12)7-17-2/h9-10H,3-7,12H2,1-2H3,(H,13,15) |
| InChIKey | LJMVRBOKGNQJPY-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |