C11H14N4O5S — CID 81084007
5-methoxy-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentanoic acid (PubChem CID 81084007) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is 5-methoxy-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentanoic acid.
| Compound Name | 5-methoxy-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 81084007 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 5-methoxy-2-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]pentanoic acid |
| SMILES | COCCCC(Nc1nc2sccn2c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C11H14N4O5S/c1-20-5-2-3-7(10(16)17)12-8-9(15(18)19)14-4-6-21-11(14)13-8/h4,6-7,12H,2-3,5H2,1H3,(H,16,17) |
| InChIKey | VPCUINRWWPXBMY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|