C13H24N2O5 — CID 81084930
2-[[4-(hydroxymethyl)piperidine-1-carbonyl]amino]-5-methoxypentanoic acid (PubChem CID 81084930) has the molecular formula C13H24N2O5 and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-[[4-(hydroxymethyl)piperidine-1-carbonyl]amino]-5-methoxypentanoic acid.
| Compound Name | 2-[[4-(hydroxymethyl)piperidine-1-carbonyl]amino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81084930 |
| Molecular Formula | C13H24N2O5 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2-[[4-(hydroxymethyl)piperidine-1-carbonyl]amino]-5-methoxypentanoic acid |
| SMILES | COCCCC(NC(=O)N1CCC(CO)CC1)C(=O)O |
| InChI | InChI=1S/C13H24N2O5/c1-20-8-2-3-11(12(17)18)14-13(19)15-6-4-10(9-16)5-7-15/h10-11,16H,2-9H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | VHNRIEXNPHOVHR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|