C12H17N3O4 — CID 81086092
5-methoxy-2-(pyridin-3-ylcarbamoylamino)pentanoic acid (PubChem CID 81086092) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 5-methoxy-2-(pyridin-3-ylcarbamoylamino)pentanoic acid.
| Compound Name | 5-methoxy-2-(pyridin-3-ylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 81086092 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 5-methoxy-2-(pyridin-3-ylcarbamoylamino)pentanoic acid |
| SMILES | COCCCC(NC(=O)Nc1cccnc1)C(=O)O |
| InChI | InChI=1S/C12H17N3O4/c1-19-7-3-5-10(11(16)17)15-12(18)14-9-4-2-6-13-8-9/h2,4,6,8,10H,3,5,7H2,1H3,(H,16,17)(H2,14,15,18) |
| InChIKey | ZUCSXXXQDIQACC-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|