C12H22F3N3O2 — CID 81088625
2-amino-5-methoxy-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentan-1-one (PubChem CID 81088625) has the molecular formula C12H22F3N3O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-amino-5-methoxy-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentan-1-one.
| Compound Name | 2-amino-5-methoxy-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 81088625 |
| Molecular Formula | C12H22F3N3O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-amino-5-methoxy-1-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pentan-1-one |
| SMILES | COCCCC(N)C(=O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3O2/c1-20-8-2-3-10(16)11(19)18-6-4-17(5-7-18)9-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | OKCNDTHBGNFDJY-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|