C15H12N4O2 — CID 81088915
5-[(quinoxalin-2-ylamino)methyl]pyridine-2-carboxylic acid (PubChem CID 81088915) has the molecular formula C15H12N4O2 and a molecular weight of 280.29 g/mol. Its IUPAC name is 5-[(quinoxalin-2-ylamino)methyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[(quinoxalin-2-ylamino)methyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 81088915 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-[(quinoxalin-2-ylamino)methyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2cnc3ccccc3n2)cn1 |
| InChI | InChI=1S/C15H12N4O2/c20-15(21)13-6-5-10(7-16-13)8-18-14-9-17-11-3-1-2-4-12(11)19-14/h1-7,9H,8H2,(H,18,19)(H,20,21) |
| InChIKey | ZNZFPVFQRDPZHE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |