C14H20N2O2S — CID 81089168
2-amino-1-(2,3-dihydro-1,4-benzothiazin-4-yl)-5-methoxypentan-1-one (PubChem CID 81089168) has the molecular formula C14H20N2O2S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydro-1,4-benzothiazin-4-yl)-5-methoxypentan-1-one.
| Compound Name | 2-amino-1-(2,3-dihydro-1,4-benzothiazin-4-yl)-5-methoxypentan-1-one |
|---|---|
| PubChem CID | 81089168 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-amino-1-(2,3-dihydro-1,4-benzothiazin-4-yl)-5-methoxypentan-1-one |
| SMILES | COCCCC(N)C(=O)N1CCSc2ccccc21 |
| InChI | InChI=1S/C14H20N2O2S/c1-18-9-4-5-11(15)14(17)16-8-10-19-13-7-3-2-6-12(13)16/h2-3,6-7,11H,4-5,8-10,15H2,1H3 |
| InChIKey | TYIJGYJDBYVBQU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|