C14H20N2O4 — CID 81089380
methyl 4-[(2-amino-5-methoxypentanoyl)amino]benzoate (PubChem CID 81089380) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 4-[(2-amino-5-methoxypentanoyl)amino]benzoate.
| Compound Name | methyl 4-[(2-amino-5-methoxypentanoyl)amino]benzoate |
|---|---|
| PubChem CID | 81089380 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 4-[(2-amino-5-methoxypentanoyl)amino]benzoate |
| SMILES | COCCCC(N)C(=O)Nc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C14H20N2O4/c1-19-9-3-4-12(15)13(17)16-11-7-5-10(6-8-11)14(18)20-2/h5-8,12H,3-4,9,15H2,1-2H3,(H,16,17) |
| InChIKey | GRJANGQHAXQNQK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|